CAS 4318-76-7
:2,5-Diaminopyridine
Description:
2,5-Diaminopyridine is an organic compound characterized by its pyridine ring substituted with two amino groups at the 2 and 5 positions. It appears as a white to off-white crystalline solid and is soluble in water and various organic solvents. This compound has a molecular formula of C5H7N3 and a molecular weight of approximately 111.13 g/mol. 2,5-Diaminopyridine is known for its role as a pharmaceutical intermediate and has been studied for its potential applications in treating certain neurological disorders, particularly in enhancing neurotransmitter release. The presence of amino groups contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, including acylation and alkylation. Additionally, it can form salts with acids, which may alter its solubility and stability. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,5-Diaminopyridine is a versatile compound with significant implications in medicinal chemistry and research.
Formula:C5H7N3
InChI:InChI=1S/C5H7N3/c6-4-1-2-5(7)8-3-4/h1-3H,6H2,(H2,7,8)
InChI key:InChIKey=MIROPXUFDXCYLG-UHFFFAOYSA-N
SMILES:NC=1C=CC(N)=NC1
Synonyms:- 2,5-Diamino Pyridine
- 2,5-Pyridinediamine
- NSC 175741
- Pyridine, 2,5-diamino-
- Pyridine-2,5-Diamine
- 2,5-Diaminopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Diaminopyridine
CAS:2,5-DiaminopyridineFormula:C5H7N3Purity:98%Color and Shape:SolidMolecular weight:109.132,5-Diaminopyridine
CAS:Formula:C5H7N3Purity:95%Color and Shape:Solid, Chunks or Crystalline PowderMolecular weight:109.1322,5-Diaminopyridine
CAS:2,5-Diaminopyridine is an organic compound that is expressed in the human body. It has been shown to inhibit the growth of cells in culture by binding to their DNA and preventing the production of hydrogen bonds. 2,5-Diaminopyridine has also been used clinically to treat inflammatory diseases such as rheumatoid arthritis. The hydrogen bond formation and inhibition of cell growth occurs at a low concentration of 2,5-Diaminopyridine. This drug may have potential as a therapeutic agent for cancer treatment because it inhibits the transcription factor CXCR4.Formula:C5H7N3Purity:Min. 98.0 Area-%Color and Shape:Yellow To Purple To Brown SolidMolecular weight:109.13 g/mol




