CymitQuimica logo

CAS 4318-78-9

:

3,5-Pyridinediamine

Description:
3,5-Pyridinediamine, also known as 3,5-diaminopyridine, is an organic compound characterized by its pyridine ring substituted with two amino groups at the 3 and 5 positions. This compound is a colorless to light yellow solid that is soluble in water and polar organic solvents, reflecting its polar nature due to the presence of amino groups. It has a molecular formula of C5H8N4 and a relatively low molecular weight. 3,5-Pyridinediamine is known for its role as a building block in the synthesis of various pharmaceuticals and agrochemicals, particularly in the development of drugs for neurological disorders. The amino groups can participate in hydrogen bonding, making the compound reactive and useful in various chemical reactions, including coupling reactions and as a ligand in coordination chemistry. Additionally, it exhibits properties that may influence its biological activity, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance.
Formula:C5H7N3
InChI:InChI=1S/C5H7N3/c6-4-1-5(7)3-8-2-4/h1-3H,6-7H2
InChI key:InChIKey=ABYXFACYSGVHCW-UHFFFAOYSA-N
SMILES:NC=1C=C(N)C=NC1
Synonyms:
  • 3,5-Diaminopyridine
  • 3,5-Pyridinediamine
  • Pyridine, 3,5-diamino-
Found 5 products.