CAS 43229-70-5
:N,O-Dibenzylated formoterol
Description:
N,O-Dibenzylated formoterol is a chemical compound that belongs to the class of beta-adrenergic agonists, specifically designed for use in respiratory therapies. It is a derivative of formoterol, which is known for its long-acting bronchodilator properties. The compound features two benzyl groups attached to the nitrogen and oxygen atoms of the formoterol structure, which may enhance its pharmacological profile and stability. Typically, beta-agonists like N,O-dibenzylated formoterol are utilized in the treatment of asthma and chronic obstructive pulmonary disease (COPD) due to their ability to relax bronchial smooth muscle and improve airflow. The compound's efficacy, safety profile, and potential side effects would be evaluated through clinical studies, as with other medications in this class. Additionally, its chemical properties, such as solubility, melting point, and reactivity, would be important for formulation and therapeutic applications. As with any pharmaceutical compound, proper handling and adherence to regulatory guidelines are essential for ensuring safety and effectiveness in clinical use.
Formula:C33H36N2O4
InChI:InChI=1S/C33H36N2O4/c1-25(19-26-13-16-30(38-2)17-14-26)35(21-27-9-5-3-6-10-27)22-32(37)29-15-18-33(31(20-29)34-24-36)39-23-28-11-7-4-8-12-28/h3-18,20,24-25,32,37H,19,21-23H2,1-2H3,(H,34,36)
InChI key:RVGUTXYKHMDBPX-UHFFFAOYSA-N
SMILES:CC(CC1=CC=C(C=C1)OC)N(CC2=CC=CC=C2)CC(C3=CC(=C(C=C3)OCC4=CC=CC=C4)NC=O)O
Synonyms:- N-[5-[1-Hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl](phenylmethyl)amino]ethyl]-2-(phenylmethoxy)phenyl]-formamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Formoterol Impurity 2 (Mixture of Diastereomers)
CAS:Formula:C33H36N2O4Color and Shape:White To Off-White SolidMolecular weight:524.66

