CAS 4331-54-8
:4-Methylcyclohexanecarboxylic acid
Description:
4-Methylcyclohexanecarboxylic acid is a cyclic carboxylic acid characterized by a cyclohexane ring with a methyl group and a carboxylic acid functional group attached to it. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a molecular formula of C8H14O2, indicating the presence of eight carbon atoms, fourteen hydrogen atoms, and two oxygen atoms. The structure features a carboxylic acid group (-COOH) that imparts acidic properties, making it soluble in polar solvents like water and alcohols. Its melting and boiling points can vary, reflecting its molecular interactions and structural characteristics. 4-Methylcyclohexanecarboxylic acid is used in organic synthesis and may serve as an intermediate in the production of various chemical compounds. Additionally, it exhibits potential applications in the fields of pharmaceuticals and materials science due to its unique structural properties. Safety precautions should be observed when handling this compound, as with all chemical substances.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c1-6-2-4-7(5-3-6)8(9)10/h6-7H,2-5H2,1H3,(H,9,10)
InChI key:InChIKey=QTDXSEZXAPHVBI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC(C)CC1
Synonyms:- 4-Methyl-1-cyclohexanecarboxylic acid,mixture of cis and trans
- 4-Methylcyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 4-methyl-
- p-Methylcyclohexanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Methylcyclohexanecarboxylic Acid (cis- and trans- mixture)
CAS:Formula:C8H14O2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:142.204-Methylcyclohexanecarboxylic acid
CAS:Formula:C8H14O2Purity:97%Color and Shape:LiquidMolecular weight:142.19564-Methyl-1-cyclohexanecarboxylic acid
CAS:4-Methyl-1-cyclohexanecarboxylic acidFormula:C8H14O2Purity:98%Color and Shape:LiquidMolecular weight:142.195554-Methyl-1-cyclohexanecarboxylic acid
CAS:Formula:C8H14O2Purity:98%Color and Shape:Liquid, ClearMolecular weight:142.1984-Methylcyclohexanecarboxylic Acid
CAS:Controlled ProductApplications 4-Methyl-cyclohexanecarboxylic Acid, is used in the esterification with methanol in the presence of KU-2 cation exchange resin which showed decrease in exchange rate with increasing temperature.
References Niyazov, A.N., et al.: Izvestiya Akademii Nauk Turkmenskoi SSR, 5, 119 (1975)Formula:C8H14O2Color and Shape:NeatMolecular weight:142.2






