CAS 433337-11-2
:1-benzyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate
Description:
1-Benzyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate is an ionic liquid characterized by its unique structure and properties. It features a 1-benzyl-3-methylimidazolium cation, which contributes to its stability and solubility in various solvents. The hexafluorophosphate anion (PF6-) is known for its high ionic conductivity and low viscosity, making this compound suitable for applications in electrochemistry and as a solvent for organic reactions. This ionic liquid typically exhibits a low melting point, allowing it to remain in a liquid state at room temperature, which is advantageous for various chemical processes. Additionally, it is often considered environmentally friendly due to its negligible vapor pressure, reducing the risk of air pollution. The compound's properties, such as thermal stability and electrochemical performance, make it a subject of interest in fields like catalysis, energy storage, and materials science. Overall, 1-benzyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate is a versatile substance with significant potential in both research and industrial applications.
Formula:C11H13F6N2P
InChI:InChI=1/C11H13N2.F6P/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;1-7(2,3,4,5)6/h2-8,10H,9H2,1H3;/q+1;-1
Synonyms:- 3-Benzyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate
- 433337-11-2 [Rn]
- T5K Cnj A1 C1R &&Pf6 [Wln]
- T5K Cnj A1R& C1 &&Pf6 [Wln]
- 1-Benzyl-3-Methylimidazolium Hexafluorophosphate
- 1-Benzyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Benzyl-3-methylimidazolium hexafluorophosphate
CAS:1-Benzyl-3-methylimidazolium hexafluorophosphateFormula:C11H13F6N2PPurity:98%Molecular weight:318.21-BENZYL-3-METHYLIMIDAZOLIUM HEXAFLUOROP
CAS:Formula:C11H13F6N2PPurity:97%Color and Shape:SolidMolecular weight:318.19851-Benzyl-3-methylimidazolium hexafluorophosphate
CAS:1-Benzyl-3-methylimidazolium hexafluorophosphateFormula:C11H13F6N2PPurity:>99%Molecular weight:318.21-Benzyl-3-methylimidazolium Hexafluorophosphate
CAS:Formula:C11H13F6N2PPurity:>98.0%(HPLC)(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:318.201-Benzyl-3-methylimidazolium hexafluorophosphate
CAS:Formula:C11H13F6N2PPurity:97%+(HPLC);RGMolecular weight:318.203




