CAS 4336-70-3
:Phosphonium, (cyanomethyl)triphenyl-, chloride (1:1)
Description:
Phosphonium, (cyanomethyl)triphenyl-, chloride (1:1), with CAS number 4336-70-3, is an organophosphorus compound characterized by a phosphonium cation and a chloride anion. The structure features a central phosphorus atom bonded to three phenyl groups and a cyanomethyl group, which contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and exhibits good solubility in polar organic solvents. It is known for its potential applications in organic synthesis, particularly as a phase-transfer catalyst or in the formation of phosphonium ylides, which are useful intermediates in various chemical reactions. The presence of the cyanomethyl group enhances its reactivity, making it a valuable building block in the synthesis of more complex molecules. Additionally, the chloride ion serves as a counterion, influencing the compound's stability and solubility. Safety precautions should be taken when handling this compound, as it may pose health risks typical of organophosphorus compounds.
Formula:C20H17NP·Cl
InChI:InChI=1S/C20H17NP.ClH/c21-16-17-22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15H,17H2;1H/q+1;/p-1
InChI key:InChIKey=ARPLQAMUUDIHIT-UHFFFAOYSA-M
SMILES:[P+](CC#N)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
Synonyms:- (Cyanomethyl)(Triphenyl)Phosphonium
- (Cyanomethyl)triphenylphosphanium chloride
- Nsc 92174
- Phosphonium, (cyanomethyl)triphenyl-, chloride
- Phosphonium, (cyanomethyl)triphenyl-, chloride (1:1)
- (Cyanomethyl)triphenylphosphonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(Cyanomethyl)triphenylphosphonium Chloride
CAS:Formula:C20H17ClNPPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:337.79(Cyanomethyl)triphenylphosphonium chloride, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C20H17ClNPPurity:98+%Color and Shape:White, PowderMolecular weight:337.79(Cyanomethyl)triphenylphosphonium chloride
CAS:Formula:C20H17ClNPPurity:95%Color and Shape:SolidMolecular weight:337.7824(Cyanomethyl)triphenylphosphonium chloride
CAS:(Cyanomethyl)triphenylphosphonium chlorideFormula:C20H17NP·ClPurity:>97%Color and Shape:SolidMolecular weight:337.78244Cyanomethyl triphenylphosphonium chloride
CAS:Formula:C20H17ClNPPurity:96%Color and Shape:Solid, CrystallineMolecular weight:337.79(Cyanomethyl)triphenylphosphonium chloride
CAS:(Cyanomethyl)triphenylphosphonium chlorideFormula:C20H17ClNPPurity:95%Molecular weight:337.78





