CAS 4337-04-6
:Ascorbyldibutyrate
Description:
Ascorbyldibutyrate, with the CAS number 4337-04-6, is a derivative of ascorbic acid (vitamin C) that is esterified with butyric acid. This compound is characterized by its antioxidant properties, which are attributed to the presence of the ascorbic acid moiety. Ascorbyldibutyrate is often utilized in cosmetic formulations and food products due to its ability to stabilize formulations and enhance the shelf life of products by preventing oxidative degradation. It is typically a white to off-white powder and is soluble in organic solvents, while its solubility in water may vary. The compound is known for its potential skin benefits, including promoting collagen synthesis and providing protection against UV-induced damage. Additionally, ascorbyldibutyrate may exhibit lower irritation potential compared to ascorbic acid, making it a favorable choice in topical applications. Overall, its unique properties make it a valuable ingredient in both the cosmetic and food industries.
Formula:C14H20O8
InChI:InChI=1/C14H20O8/c1-3-5-9(16)20-7-8(15)12-11(18)13(14(19)22-12)21-10(17)6-4-2/h8,12,15,18H,3-7H2,1-2H3/t8-,12+/m0/s1
Synonyms:- L-Ascorbyl 2,6-dibutyrate
- (5R)-5-[(1S)-2-(butanoyloxy)-1-hydroxyethyl]-4-hydroxy-2-oxo-2,5-dihydrofuran-3-yl butanoate (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Ascorbyl 2,6-Dibutyrate
CAS:Formula:C14H20O8Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:316.31L-Ascorbyl 2,6-Dibutyrate
CAS:L-Ascorbyl 2,6-DibutyrateFormula:C14H20O8Purity:>98.0%Molecular weight:316.31L-AScorbyl 2,6-dibutyrate
CAS:Formula:C14H20O8Purity:98.0%Color and Shape:SolidMolecular weight:316.3038L-Ascorbic acid, 2,6-dibutanoate
CAS:L-Ascorbic acid, 2,6-dibutanoate is a biochemical reagent that can be used as a biomaterial for life science related research and as a sulfonylation reagent for organic synthesis and drug discovery.Formula:C14H20O8Color and Shape:SolidMolecular weight:316.3




