CymitQuimica logo

CAS 4354-56-7

:

6-cyclohexylhexanoic acid

Description:
6-Cyclohexylhexanoic acid is an organic compound characterized by its carboxylic acid functional group and a cyclohexyl substituent on the hexanoic acid chain. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a relatively high molecular weight and exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic cyclohexyl group. The presence of the cyclohexyl ring contributes to its unique physical and chemical properties, including potential applications in the synthesis of various chemical intermediates and as a building block in organic chemistry. Additionally, 6-cyclohexylhexanoic acid may exhibit interesting biological activities, although specific studies on its biological effects may be limited. Its CAS number, 4354-56-7, is used for identification in chemical databases and regulatory contexts. As with many organic acids, it is important to handle this compound with care, observing appropriate safety protocols to mitigate any risks associated with its use.
Formula:C12H22O2
InChI:InChI=1/C12H22O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h11H,1-10H2,(H,13,14)
InChI key:FIDNHQYXZUPELG-UHFFFAOYSA-N
SMILES:C1CCC(CC1)CCCCCC(=O)O
Found 5 products.