CAS 4356-82-5: Methyl 2,3,4-tris-O-(phenylmethyl)-beta-D-glucopyranosiduronic acid
Description:Methyl 2,3,4-tris-O-(phenylmethyl)-beta-D-glucopyranosiduronic acid, with the CAS number 4356-82-5, is a complex carbohydrate derivative characterized by its glucuronic acid structure modified with phenylmethyl (benzyl) groups at the 2, 3, and 4 positions. This compound exhibits properties typical of glycosides, including solubility in polar solvents and potential reactivity due to the presence of the uronic acid moiety. The phenylmethyl substituents enhance its hydrophobic character, which can influence its interactions in biological systems and its solubility profile. The presence of the methyl group indicates that it is a methyl ester, which can affect its stability and reactivity. This compound may be of interest in biochemical research, particularly in studies involving glycosylation, enzyme interactions, or as a potential building block in the synthesis of more complex glycosides or polysaccharides. Its specific applications would depend on its reactivity and the functional groups present, making it a valuable compound in organic and medicinal chemistry.
Formula:C28H30O7
InChI:InChI=1/C28H30O7/c1-31-28-26(34-19-22-15-9-4-10-16-22)24(33-18-21-13-7-3-8-14-21)23(25(35-28)27(29)30)32-17-20-11-5-2-6-12-20/h2-16,23-26,28H,17-19H2,1H3,(H,29,30)/t23-,24-,25-,26+,28+/m0/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl2,3,4-tris-O-(phenylmethyl)-b-D-glucopyranosiduronicacid REF: 3D-FM152928CAS: 4356-82-5 | Min. 95% | - - - | Discontinued product |

Methyl2,3,4-tris-O-(phenylmethyl)-b-D-glucopyranosiduronicacid
Ref: 3D-FM152928
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information |