CAS 436-77-1
:Fangchinoline
Description:
Fangchinoline is an alkaloid compound primarily derived from the plant species *Stephania* and is known for its various biological activities. It is characterized by its complex tetracyclic structure, which contributes to its pharmacological properties. Fangchinoline exhibits a range of effects, including anti-inflammatory, analgesic, and potential anticancer activities, making it of interest in medicinal chemistry and pharmacology. The compound has been studied for its ability to modulate various biological pathways, including those involved in cell proliferation and apoptosis. Additionally, fangchinoline has shown promise in traditional medicine, particularly in Asian herbal practices. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in research and potential therapeutic uses. As with many natural products, further studies are needed to fully elucidate its mechanisms of action and therapeutic potential. Safety and toxicity profiles are also critical considerations for any future applications in clinical settings.
Formula:C37H40N2O6
InChI:InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m0/s1
InChI key:InChIKey=IIQSJHUEZBTSAT-VMPREFPWSA-N
SMILES:OC1=C2C=3[C@](CC=4C=C(C(OC)=CC4)OC=5C=CC(C[C@]6(C7=CC(O2)=C(OC)C=C7CCN6C)[H])=CC5)(N(C)CCC3C=C1OC)[H]
Synonyms:- (+)-Hanfangichin B
- (+)-Limacine
- (1beta)-6,6',12-Trimethoxy-2,2'-dimethylberbaman-7-ol
- (4aS,16aS)-3,4,4a,5,16a,17,18,19-Octahydro-12,21,26-trimethoxy-4,17-dimethyl-16H-1,24:6,9-dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-22-ol
- 16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-22-ol, 3,4,4a,5,16a,17,18,19-octahydro-12,21,26-trimethoxy-4,17-dimethyl-, (4aS,16aS)-
- 16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-22-ol, 3,4,4a,5,16a,17,18,19-octahydro-12,21,26-trimethoxy-4,17-dimethyl-, [4aS-(4aR*,16aR*)]-
- 6,6',12-Trimethoxy-2,2'-Dimethylberbaman-7-Ol
- 7-O-Demethyltetrandrine
- Berbaman-7-ol, 6,6′,12-trimethoxy-2,2′-dimethyl-, (1β)-
- Hanfangchin B
- NSC 77036
- (+)-Fangchinoline
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2',3':17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-22-ol,3,4,4a,5,16a,17,18,19-octahydro-12,21,26-trimethoxy-4,17-dimethyl-,(4aS,16aS)-
CAS:Formula:C37H40N2O6Purity:98%Color and Shape:SolidMolecular weight:608.7233Fangchinoline
CAS:FangchinolineFormula:C37H40N2O6Purity:>98%Color and Shape:SolidMolecular weight:608.72Fangchinoline
CAS:Formula:C37H40N2O6Purity:>97.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:608.74Hanfangchin B
CAS:Fangchinoline and tetrandrine are the major alkaloids from Stephania tetrandrae S. they shows anti-inflammatory effects on mouse ear edema induced by croton oil, the biochemical mechanisms of fangchinoline and tetrandrine on anti-inflammation are significantly different even though they are similar in chemical structure.Formula:C37H40N2O6Purity:95%~99%Color and Shape:PowderMolecular weight:608.735Fangchinoline
CAS:Fangchinoline (Tetrandrine B) is extracted from Stephania tetrandra S. Moore.Formula:C37H40N2O6Purity:99.86% - >99.99%Color and Shape:SolidMolecular weight:608.72Fangchinoline
CAS:Natural alkaloidFormula:C37H40N2O6Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:608.72(+)-Fangchinoline
CAS:(+)-Fangchinoline is a bisbenzylisoquinoline alkaloid, which is derived from the roots of Stephania plants, particularly Stephania tetrandra. These plants are known for their diverse array of alkaloids, which have been studied for their pharmacological properties. The mode of action of (+)-Fangchinoline is multifaceted, involving interactions with various cellular pathways, including modulation of calcium channels and inhibition of acetylcholinesterase. It also exhibits antioxidant, anti-inflammatory, and potential anticancer activities, demonstrating its ability to interfere with key molecular and cellular processes.Formula:C37H40N2O6Purity:Min. 95%Molecular weight:608.72 g/mol









