CymitQuimica logo

CAS 436096-46-7

:

2,7,8-trimethylquinoline-4-carboxylic acid

Description:
2,7,8-Trimethylquinoline-4-carboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features three methyl groups located at the 2, 7, and 8 positions of the quinoline ring, contributing to its hydrophobic properties and influencing its reactivity. The presence of a carboxylic acid functional group at the 4-position enhances its polarity and solubility in polar solvents, making it useful in various chemical applications. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its unique structure allows for interactions with biological systems, which can be explored for potential therapeutic effects. Additionally, the compound's stability and reactivity can be influenced by the substituents on the quinoline ring, making it a subject of interest in organic synthesis and medicinal chemistry. As with many quinoline derivatives, it may also exhibit fluorescence, which can be utilized in analytical applications.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c1-7-4-5-10-11(13(15)16)6-8(2)14-12(10)9(7)3/h4-6H,1-3H3,(H,15,16)
InChI key:HRQOZCJRHHXDEK-UHFFFAOYSA-N
SMILES:Cc1ccc2c(cc(C)nc2c1C)C(=O)O
Found 2 products.