CymitQuimica logo

CAS 4368-68-7

:

1-benzyl-1H-1,2,3-triazole

Description:
1-Benzyl-1H-1,2,3-triazole is a heterocyclic organic compound characterized by its five-membered ring structure containing two nitrogen atoms. This compound features a benzyl group attached to the triazole ring, which contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The presence of the triazole moiety imparts notable biological activity, making it of interest in medicinal chemistry, particularly for its potential as an antifungal or antibacterial agent. Additionally, 1-benzyl-1H-1,2,3-triazole can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the reactivity of the triazole ring. Its stability and reactivity make it a valuable intermediate in organic synthesis and a subject of study in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c1-2-4-9(5-3-1)8-12-7-6-10-11-12/h1-7H,8H2
InChI key:VRDSRXVCRBMZOD-UHFFFAOYSA-N
SMILES:c1ccc(cc1)Cn1ccnn1
Synonyms:
  • 1-Benzyl-1,2,3-triazole
Found 4 products.