CymitQuimica logo

CAS 437982-59-7

:

tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate

Description:
Tert-butyl 5-amino-3-cyclopropyl-1H-pyrazole-1-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of the tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The amino group at the 5-position of the pyrazole ring contributes to its potential as a building block in medicinal chemistry, as amino groups are often involved in hydrogen bonding and can enhance biological activity. The cyclopropyl substituent at the 3-position introduces strain and unique steric properties, which can influence the compound's reactivity and interaction with biological targets. The carboxylate functional group at the 1-position is typically involved in acid-base chemistry and can participate in various chemical reactions, including esterification and amidation. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents.
Formula:C11H17N3O2
InChI:InChI=1S/C11H17N3O2/c1-11(2,3)16-10(15)14-9(12)6-8(13-14)7-4-5-7/h6-7H,4-5,12H2,1-3H3
InChI key:LIRVTXMQFQGLQV-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C(=CC(=N1)C2CC2)N
Found 4 products.