CAS 438045-89-7: Rebaudioside F
Description:Rebaudioside F is a natural sweetener derived from the leaves of the Stevia rebaudiana plant, which is known for its high sweetness intensity and low-calorie content. It belongs to a class of compounds known as steviol glycosides, which are responsible for the sweet taste of stevia. Rebaudioside F is characterized by its ability to provide sweetness without contributing significant calories, making it a popular choice for sugar substitutes in food and beverage products. It is generally recognized as safe (GRAS) by various food safety authorities when used within established limits. The compound exhibits a clean taste profile, with minimal aftertaste compared to other steviol glycosides, which enhances its appeal in formulations. Additionally, Rebaudioside F is soluble in water and stable under various pH conditions, making it versatile for different applications. Its sweetness is attributed to the presence of multiple hydroxyl groups that interact with taste receptors, providing a sweet flavor without the adverse effects associated with high sugar consumption.
Formula:C43H68O22
InChI:InChI=1S/C43H68O22/c1-17-11-42-9-5-22-40(2,7-4-8-41(22,3)39(57)64-37-32(56)29(53)26(50)20(13-45)60-37)23(42)6-10-43(17,16-42)65-38-34(63-35-30(54)24(48)18(47)15-58-35)33(27(51)21(14-46)61-38)62-36-31(55)28(52)25(49)19(12-44)59-36/h18-38,44-56H,1,4-16H2,2-3H3/t18-,19-,20-,21-,22+,23+,24+,25-,26-,27-,28+,29+,30-,31-,32-,33+,34-,35+,36+,37+,38+,40-,41-,42-,43+/m1/s1
InChI key:InChIKey=HYLAUKAHEAUVFE-AVBZULRRSA-N
SMILES:O=C(OC1OC(CO)C(O)C(O)C1O)C2(C)CCCC3(C)C2CCC45CC(=C)C(OC6OC(CO)C(O)C(OC7OC(CO)C(O)C(O)C7O)C6OC8OCC(O)C(O)C8O)(CCC43)C5
- Synonyms:
- Rebaudioside F
- Kaur-16-en-18-oic acid, 13-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-β-D-glucopyranosyl)oxy]-, β-D-glucopyranosyl ester, (4α)-
