CAS 438045-89-7
:Rebaudioside F
Description:
Rebaudioside F is a natural sweetener derived from the leaves of the Stevia rebaudiana plant, which is known for its high sweetness intensity and low-calorie content. It belongs to a class of compounds known as steviol glycosides, which are responsible for the sweet taste of stevia. Rebaudioside F is characterized by its ability to provide sweetness without contributing significant calories, making it a popular choice for sugar substitutes in food and beverage products. It is generally recognized as safe (GRAS) by various food safety authorities when used within established limits. The compound exhibits a clean taste profile, with minimal aftertaste compared to other steviol glycosides, which enhances its appeal in formulations. Additionally, Rebaudioside F is soluble in water and stable under various pH conditions, making it versatile for different applications. Its sweetness is attributed to the presence of multiple hydroxyl groups that interact with taste receptors, providing a sweet flavor without the adverse effects associated with high sugar consumption.
Formula:C43H68O22
InChI:InChI=1S/C43H68O22/c1-17-11-42-9-5-22-40(2,7-4-8-41(22,3)39(57)64-37-32(56)29(53)26(50)20(13-45)60-37)23(42)6-10-43(17,16-42)65-38-34(63-35-30(54)24(48)18(47)15-58-35)33(27(51)21(14-46)61-38)62-36-31(55)28(52)25(49)19(12-44)59-36/h18-38,44-56H,1,4-16H2,2-3H3/t18-,19-,20-,21-,22+,23+,24+,25-,26-,27-,28+,29+,30-,31-,32-,33+,34-,35+,36+,37+,38+,40-,41-,42-,43+/m1/s1
InChI key:InChIKey=HYLAUKAHEAUVFE-AVBZULRRSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@](O[C@H]5[C@H](O[C@H]6[C@H](O)[C@@H](O)[C@H](O)CO6)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@@H](CO)O5)(C(=C)C4)CC3)CC[C@@]1([C@@](C(O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O)[C@H]8O)=O)(C)CCC2)[H])[H]
Synonyms:- Rebaudioside F
- Kaur-16-en-18-oic acid, 13-[(O-β-D-glucopyranosyl-(1→3)-O-[β-D-xylopyranosyl-(1→2)]-β-D-glucopyranosyl)oxy]-, β-D-glucopyranosyl ester, (4α)-
- Rebaudioside Impurity F
- REBAUDIOSIDE F(P)
- (4alpha)-13-[(O-beta-D-Glucopyranosyl-(1-3)-O-[beta-D-xylopyranosyl-(1-2)]-beta-D-glucopyranosyl)oxy]-kaur-16-en-18-oic acid beta-D-glucopyranosyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Rebaudioside F
CAS:Rebaudioside FFormula:C43H68O22Purity:≥98%Color and Shape:SolidMolecular weight:936.99Rebaudioside F
CAS:Formula:C43H68O22Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:937.00Rebaudioside F
CAS:Rebaudioside F is a natural diterpene glycoside that is metabolised by Cyclodextrin glucanotransferase and biochemical experiments and organic synthesis.Formula:C43H68O22Purity:98.5%Color and Shape:SolidMolecular weight:936.99Rebaudioside F (Standard)
CAS:Rebaudioside F (Standard) is a reference standard for research and analysis in studies involving Rebaudioside F. Rebaudioside F is a natural diterpene glycoside that is metabolised by Cyclodextrin glucanotransferase and can be used in biochemical experiments and organic synthesis.Formula:C43H68O22Color and Shape:SolidMolecular weight:936.99Rebaudioside F
CAS:Natural glycosideFormula:C43H68O22Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:936.99Rebaudioside F
CAS:(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl (9S,11aS,11bS)-9-(((2S,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-4-(((2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-4,11b-dimethyl-8-methylenetetradecahydro-6a,9-methanocyclohepta[a]naphthalene-4-carboxylateFormula:C43H68O22Purity:98%Molecular weight:936.99Rebaudioside F
CAS:Rebaudioside F is a non-caloric sweetener, which is a glycoside isolated from the leaves of Stevia rebaudiana. This compound is categorized as a steviol glycoside, where the steviol backbone is modified through glycosylation, contributing to its sweetening properties. Rebaudioside F shares a similar structure with other steviol glycosides, including rebaudioside A, but exhibits slight differences in its glycosylation pattern, which can influence its taste profile and solubility.
Formula:C43H68O22Purity:Min. 95%Color and Shape:PowderMolecular weight:936.99 g/molRef: 3D-OR44889
Discontinued product









