CymitQuimica logo

CAS 4408-47-3

:

Bisaminobenzalethylenediamine; 95%

Description:
Bisaminobenzalethylenediamine, with the CAS number 4408-47-3, is an organic compound characterized by its structure, which includes two amino groups and a benzaldehyde moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including polymer chemistry and as a curing agent in epoxy resins. It exhibits properties such as good solubility in organic solvents and the ability to form cross-links in polymer matrices, enhancing mechanical strength and thermal stability. The presence of amino groups allows for reactivity in condensation reactions, making it useful in synthesizing more complex molecules. Additionally, it may possess biological activity, although specific biological properties can vary based on the context of use. Safety data sheets indicate that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, Bisaminobenzalethylenediamine is a versatile compound with significant industrial relevance.
Formula:C16H18N4
InChI:InChI=1/C16H18N4/c17-15-7-3-1-5-13(15)11-19-9-10-20-12-14-6-2-4-8-16(14)18/h1-8,11-12H,9-10,17-18H2/b19-11+,20-12+
InChI key:ZFIFWHZGMOGXDV-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2N)N
Synonyms:
  • N,N-Bis(2-aminobenzal)ethylenediamine
  • N,N'-bis[(1E)-(2-aminophenyl)methylidene]ethane-1,2-diamine
Found 3 products.