CymitQuimica logo

CAS 4414-89-5

:

1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile

Description:
1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile, with the CAS number 4414-89-5, is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a pale yellow to brown solid appearance and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the carbonitrile functional group enhances its reactivity and can influence its interactions in biological systems. It is soluble in polar organic solvents, which facilitates its use in various chemical reactions and applications. The compound may also exhibit fluorescence properties, making it useful in certain analytical techniques. Additionally, its structural features allow for potential modifications that can lead to derivatives with enhanced pharmacological profiles. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, further expanding its utility in synthetic organic chemistry.
Formula:C8H5N3
InChI:InChI=1S/C8H5N3/c9-4-6-5-11-8-7(6)2-1-3-10-8/h1-3,5H,(H,10,11)
InChI key:InChIKey=MUCWDACENIACBH-UHFFFAOYSA-N
SMILES:C(#N)C=1C=2C(NC1)=NC=CC2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-3-carbonitril
  • 3-Cyano-7-azaindole
  • 7-Azaindole-3-carbonitrile
  • 1H-Pyrrolo[2,3-b]pyridine-3-carbonitrile
Found 4 products.