CymitQuimica logo

CAS 4423-79-4

:

1,4-Dioxaspiro[4.5]decan-2-one

Description:
1,4-Dioxaspiro[4.5]decan-2-one is a cyclic organic compound characterized by its unique spiro structure, which consists of a dioxane ring fused to a decanone framework. This compound features two ether oxygen atoms within the dioxane moiety and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the spiro configuration imparts distinctive stereochemical properties, influencing its physical and chemical behavior. Typically, such compounds exhibit moderate polarity due to the presence of oxygen atoms, which can engage in hydrogen bonding. 1,4-Dioxaspiro[4.5]decan-2-one may be utilized in various chemical reactions, including cycloadditions and as intermediates in the synthesis of more complex molecules. Its CAS number, 4423-79-4, allows for easy identification in chemical databases. While specific physical properties such as boiling point, melting point, and solubility can vary, they are generally influenced by the compound's molecular structure and functional groups. Overall, this compound represents an interesting class of spiro compounds with potential utility in medicinal chemistry and materials science.
Formula:C8H12O3
InChI:InChI=1S/C8H12O3/c9-7-6-10-8(11-7)4-2-1-3-5-8/h1-6H2
InChI key:InChIKey=HBGAMCTZOLJGAS-UHFFFAOYSA-N
SMILES:O=C1OC2(OC1)CCCCC2
Synonyms:
  • 2,2-Pentamethylene-1,3-dioxolan-4-one
  • Acetic acid, [(1-hydroxycyclohexyl)oxy]-, γ-lactone
  • 1,4-Dioxaspiro[4.5]decan-2-one
  • 1,4-Dioxaspiro[4.5]decan-2-one
Found 6 products.