CymitQuimica logo

CAS 442531-57-9

:

1-(2-Methoxyphenyl)-1H-benzimidazole-5-carboxylic acid

Description:
1-(2-Methoxyphenyl)-1H-benzimidazole-5-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methoxyphenyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for hydrogen bonding due to the presence of the carboxylic acid. It may display moderate solubility in polar solvents, influenced by the methoxy group, which can enhance its solubility compared to unsubstituted benzimidazoles. The presence of the carboxylic acid group suggests potential for acid-base reactions and interactions with biological systems, making it of interest in pharmaceutical research. Additionally, compounds of this class may exhibit biological activities, including antimicrobial or anticancer properties, although specific activities would depend on further empirical studies. Overall, this compound's structural features contribute to its potential utility in various chemical and biological applications.
Formula:C15H12N2O3
InChI:InChI=1S/C15H12N2O3/c1-20-14-5-3-2-4-13(14)17-9-16-11-8-10(15(18)19)6-7-12(11)17/h2-9H,1H3,(H,18,19)
InChI key:InChIKey=SRWLCOROBOXDFJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(N2C=3C(N=C2)=CC(C(O)=O)=CC3)C=CC=C1
Synonyms:
  • 1-(2-Methoxyphenyl)-1H-benzimidazole-5-carboxylic acid
  • 1-(2-Methoxyphenyl)-1H-benzo[d]imidazole-5-carboxylic acid
  • 1-(2-Methoxyphenyl)-1H-1,3-benzodiazole-5-carboxylic acid
  • 1H-Benzimidazole-5-carboxylic acid, 1-(2-methoxyphenyl)-
Found 2 products.