CAS 443144-25-0
:3-Cyano-1H-indole-7-carboxylic acid
Description:
3-Cyano-1H-indole-7-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a cyano group (-C≡N) at the 3-position and a carboxylic acid group (-COOH) at the 7-position of the indole ring, contributing to its acidic properties and potential reactivity. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the carboxylic acid group can engage in hydrogen bonding and act as a proton donor. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a versatile building block in organic synthesis. Additionally, the compound's unique structure may contribute to specific interactions in biological systems, warranting further investigation into its pharmacological properties.
Formula:C10H6N2O2
InChI:InChI=1S/C10H6N2O2/c11-4-6-5-12-9-7(6)2-1-3-8(9)10(13)14/h1-3,5,12H,(H,13,14)
InChI key:InChIKey=FDASYGXNFLWEMM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(C#N)=CN2)=CC=C1
Synonyms:- 3-Cyano-1H-indole-7-carboxylic acid
- 1H-Indole-7-carboxylic acid, 3-cyano-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Cyano-1H-indole-7-carboxylic acid
CAS:3-Cyano-1H-indole-7-carboxylic acidFormula:C10H6N2O2Purity:95+%Molecular weight:186.173-cyano-1h-indole-7-carboxylic acid
CAS:3-cyano-1H-indole-7-carboxylic acid is a potent, selective, and competitive inhibitor of the insulin receptor tyrosine kinase. It has been shown to be a more potent inhibitor of insulin receptor tyrosine kinase than insulin itself. 3-cyano-1H-indole-7-carboxylic acid binds to the ATP binding site on the receptor and blocks ATP binding, which prevents downstream signaling and leads to inhibition of cell proliferation. 3-cyano-1H-indole-7-carboxylic acid also inhibits the growth of cells in culture by altering cellular metabolism via inhibition of protein synthesis. The chemical structure of 3-(3'-cyanobiphenyl)-2-[(2'-propenyl)amino]-N-[4'-nitrobenzoyl]benzamide is similar to that of other known inhibitors such as piperazine and 2-(4'-nitroFormula:C10H6N2O2Purity:Min. 95%Molecular weight:186.17 g/mol



