CymitQuimica logo

CAS 4432-44-4

:

4-Morpholinepropanoicacid, a-methylene-

Description:
4-Morpholinepropanoic acid, α-methylene- (CAS 4432-44-4) is an organic compound characterized by its morpholine ring structure and a propanoic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile intermediate in organic synthesis. It is often used in the development of pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions, such as amide formation and alkylation. The presence of the morpholine ring contributes to its solubility in polar solvents and its potential to form hydrogen bonds, which can influence its reactivity and interaction with biological systems. Additionally, the α-methylene group enhances its reactivity, allowing it to undergo further transformations. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, to ensure safe laboratory practices. Overall, 4-Morpholinepropanoic acid, α-methylene- is a valuable compound in synthetic organic chemistry with applications in multiple fields.
Formula:C8H13NO3
InChI:InChI=1S/C8H13NO3/c1-7(8(10)11)6-9-2-4-12-5-3-9/h1-6H2,(H,10,11)
InChI key:IGZSSKAOSOCVPH-UHFFFAOYSA-N
SMILES:C=C(CN1CCOCC1)C(=O)O
Synonyms:
  • 4-Morpholinepropionicacid, a-methylene- (8CI)
  • Acrylic acid,2-(morpholinomethyl)-
Found 3 products.