CAS 4433-01-6
:2,2'-Bipyridine-3,3'-dicarboxylic acid
Description:
2,2'-Bipyridine-3,3'-dicarboxylic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features two carboxylic acid functional groups (-COOH) located at the 3 and 3' positions of the bipyridine framework, contributing to its acidic properties. It is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid groups. The compound is of interest in coordination chemistry, as it can act as a bidentate ligand, forming stable complexes with various metal ions. Additionally, its structural features make it useful in the synthesis of more complex organic molecules and materials. The presence of the carboxylic acid groups also allows for potential applications in biological systems and as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H8N2O4
InChI:InChI=1/C12H8N2O4/c15-11(16)7-3-1-5-13-9(7)10-8(12(17)18)4-2-6-14-10/h1-6H,(H,15,16)(H,17,18)
SMILES:c1cc(c(c2c(cccn2)C(=O)O)nc1)C(=O)O
Synonyms:- 2,2'-Bipyridin-3,3'-dicarbons?ure
- A 4433-01-6
- Acide 2,2'-bipyridine-3,3'-dicarboxylique
- 2,2'-Bipyridine-3,3'-dicarboxylic acid
- 2,2′-Bipyridine-3,3′?dicarboxylic acid
- [2,2'-bipyridine]-3,3'-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2'-Bipyridine-3,3'-dicarboxylic Acid
CAS:Formula:C12H8N2O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:244.21[2,2'-Bipyridine]-3,3'-dicarboxylic acid
CAS:Formula:C12H8N2O4Purity:97%Color and Shape:SolidMolecular weight:244.20292,2'-Bipyridine-3,3'-dicarboxylic acid
CAS:2,2'-Bipyridine-3,3'-dicarboxylic acidFormula:C12H8N2O4Purity:97%Color and Shape:SolidMolecular weight:244.207[2,2′-Bipyridine]-3,3′-dicarboxylic acid
CAS:Formula:C12H8N2O4Purity:97%Color and Shape:White to almost white powderMolecular weight:244.2062,2'-Bipyridine-3,3'-dicarboxylic acid
CAS:2,2'-Bipyridine-3,3'-dicarboxylic acid is a coordination compound that contains two carboxylic acid groups. It forms a dihydrate in water and is orthorhombic in crystal form. The molecule can be represented by the following chemical structure:Formula:C12H8N2O4Purity:Min. 95%Color and Shape:SolidMolecular weight:244.2 g/mol




