CymitQuimica logo

CAS 443956-08-9

:

2-Bromo-5-hydroxy-6-nitropyridine

Description:
2-Bromo-5-hydroxy-6-nitropyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position, a hydroxyl group (-OH) at the 5-position, and a nitro group (-NO2) at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the compound in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the bromine atom can serve as a leaving group in certain reactions, making this compound potentially useful in synthetic organic chemistry. Its specific applications may vary, but it could be relevant in the development of pharmaceuticals or agrochemicals, given the functional groups present that can participate in further chemical transformations.
Formula:C5H3BrN2O3
InChI:InChI=1S/C5H3BrN2O3/c6-4-2-1-3(9)5(7-4)8(10)11/h1-2,9H
InChI key:GSGNTVQLHGOEMB-UHFFFAOYSA-N
SMILES:c1cc(Br)nc(c1O)N(=O)=O
Synonyms:
  • 2-Nitro-3-Hydroxy-6-Bromopyridine
  • 6-Bromo-2-nitropyridin-3-ol
  • 6-Bromo-2-nitro-pyridin-3-ol
Found 4 products.