CAS 4443-26-9
:1,3-Dihydro-1,3-dioxo-2H-isoindole-2-hexanoic acid
Description:
1,3-Dihydro-1,3-dioxo-2H-isoindole-2-hexanoic acid, with the CAS number 4443-26-9, is a chemical compound characterized by its unique bicyclic structure, which includes an isoindole framework. This compound features two carbonyl groups (dioxo) and a hexanoic acid side chain, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. The presence of the dioxo groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Additionally, the hexanoic acid moiety can influence its biological activity and solubility properties. While specific applications may vary, compounds of this nature are often explored in medicinal chemistry and materials science for their potential therapeutic effects or as intermediates in the synthesis of more complex molecules. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.
Formula:C14H15NO4
InChI:InChI=1S/C14H15NO4/c16-12(17)8-2-1-5-9-15-13(18)10-6-3-4-7-11(10)14(15)19/h3-4,6-7H,1-2,5,8-9H2,(H,16,17)
InChI key:InChIKey=QJDSLDWVMCWWCO-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCCCC(O)=O)=CC=CC2
Synonyms:- 2-Isoindolinehexanoic acid, 1,3-dioxo-
- 2H-Isoindole-2-hexanoic acid, 1,3-dihydro-1,3-dioxo-
- 6-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)hexanoic acid
- 6-(1,3-Dioxoisoindolin-2-yl)hexanoic acid
- 6-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)hexanoic acid
- 6-Phthalimidohexanoic acid
- Phthalimidocapronic acid
- ε-Phthalimidocaproic acid
- ω-Phthalimidocaproic acid
- 1,3-Dihydro-1,3-dioxo-2H-isoindole-2-hexanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-(1,3-Dioxoisoindol-2-yl)hexanoic acid
CAS:Formula:C14H15NO4Purity:97%Color and Shape:SolidMolecular weight:261.2732N-(5-Carboxypentyl)phthalimide
CAS:N-(5-Carboxypentyl)phthalimideFormula:C14H15NO4Purity:98%Color and Shape:PowderMolecular weight:261.27326-(1,3-Dioxoisoindolin-2-yl)hexanoic Acid
CAS:Controlled ProductFormula:C14H15NO4Color and Shape:NeatMolecular weight:261.27O-Phthalimide-C5-acid
CAS:6-(1,3-Dioxoisoindolin-2-yl)hexanoic acidFormula:C14H15NO4Purity:98%Molecular weight:261.27O-Phthalimide-C5-acid
CAS:6-N-Phthalimidoy hexanoic acid (compound FH) is a hapten featuring a carboxyl group at its spacer arm terminus, facilitating reaction with proteins' free amine groups. This compound is capable of conjugation with carrier proteins for use in antigen design [1].Formula:C14H15NO4Color and Shape:SolidMolecular weight:261.2736-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-hexanoic acid
CAS:Formula:C14H15NO4Purity:97%Color and Shape:SolidMolecular weight:261.277Ref: 10-F028170
Discontinued product







