CymitQuimica logo

CAS 4444-68-2

:

N,N-diethylbutylamine

Description:
N,N-Diethylbutylamine is an organic compound classified as a tertiary amine. It features a butyl group attached to a nitrogen atom, which is also bonded to two ethyl groups. This structure contributes to its unique chemical properties, including its relatively low boiling point and moderate solubility in organic solvents. N,N-Diethylbutylamine is typically a colorless to pale yellow liquid with a characteristic amine odor. It is known for its role as a reagent in organic synthesis and as a potential intermediate in the production of various chemical compounds. The compound exhibits basicity due to the presence of the nitrogen atom, allowing it to participate in acid-base reactions. Additionally, it may have applications in the pharmaceutical and agrochemical industries. However, like many amines, it can be hazardous, necessitating careful handling to avoid exposure. Safety data sheets should be consulted for specific handling and storage guidelines.
Formula:C8H19N
InChI:InChI=1/C8H19N/c1-4-7-8-9(5-2)6-3/h4-8H2,1-3H3
InChI key:ORSUTASIQKBEFU-UHFFFAOYSA-N
SMILES:CCCCN(CC)CC
Synonyms:
  • Ccris 6017
  • Diethylbutylamine
  • 1-Butanamine, N,N-diethyl-
  • N,N-diethylbutan-1-amine
Found 4 products.