CymitQuimica logo

CAS 444723-13-1

:

NU6140

Description:
NU6140, with the CAS number 444723-13-1, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role as a selective inhibitor of certain protein kinases, which are crucial in various cellular processes, including cell growth and division. The compound exhibits a specific affinity for its target, making it a subject of interest in pharmaceutical research, particularly in the context of cancer therapy and other diseases where dysregulated kinase activity is implicated. NU6140's molecular structure includes functional groups that contribute to its biological activity and solubility properties. Additionally, it has been studied for its pharmacokinetic profile, which encompasses absorption, distribution, metabolism, and excretion characteristics. As with many investigational compounds, ongoing research aims to elucidate its efficacy and safety in clinical settings, providing insights into its potential therapeutic applications.
Formula:C23H30N6O2
InChI:InChI=1S/C23H30N6O2/c1-3-29(4-2)22(30)17-10-12-18(13-11-17)26-23-27-20-19(24-15-25-20)21(28-23)31-14-16-8-6-5-7-9-16/h10-13,15-16H,3-9,14H2,1-2H3,(H2,24,25,26,27,28)
InChI key:XHEQSRJCJTWWAH-UHFFFAOYSA-N
SMILES:CCN(CC)C(=O)C1=CC=C(C=C1)NC2=NC3=C(C(=N2)OCC4CCCCC4)NC=N3
Found 8 products.