CymitQuimica logo

CAS 445-04-5

:

4-amino-3-(trifluoromethyl)phenol

Description:
4-Amino-3-(trifluoromethyl)phenol, with the CAS number 445-04-5, is an organic compound characterized by the presence of an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to a phenolic ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the compound's lipophilicity and metabolic stability, making it of interest in drug design. The amino group contributes to its reactivity, allowing for further chemical modifications. Additionally, 4-amino-3-(trifluoromethyl)phenol exhibits properties such as solubility in polar solvents and may participate in hydrogen bonding due to the hydroxyl group (-OH) inherent in phenols. Its unique structure and functional groups can influence its biological activity and interactions with other chemical entities, making it a subject of study in medicinal chemistry and material science. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H6F3NO
InChI:InChI=1/C7H6F3NO/c8-7(9,10)5-3-4(12)1-2-6(5)11/h1-3,12H,11H2
InChI key:VORRYOXJWMUREO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1O)C(F)(F)F)N
Synonyms:
  • Phenol, 4-Amino-3-(Trifluoromethyl)-
Found 4 products.