CAS 4453-82-1
:Dicyclohexylmethanol
Description:
Dicyclohexylmethanol is an organic compound characterized by its structure, which features two cyclohexyl groups attached to a methanol moiety. This compound is typically a colorless to pale yellow liquid with a relatively high boiling point, indicative of its larger molecular size and the presence of multiple carbon rings. It is known for its low solubility in water, but it is soluble in organic solvents, making it useful in various chemical applications. Dicyclohexylmethanol can serve as a solvent, a reagent in organic synthesis, or as an intermediate in the production of other chemical compounds. Its chemical stability and relatively low reactivity under standard conditions make it a suitable candidate for use in various industrial processes. Additionally, it may exhibit mild toxicity, necessitating appropriate safety measures during handling. Overall, dicyclohexylmethanol is valued in both research and industrial settings for its unique properties and versatility in organic chemistry.
Formula:C13H24O
InChI:InChI=1S/C13H24O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-14H,1-10H2
InChI key:InChIKey=DEFUSPNGFCCTEU-UHFFFAOYSA-N
SMILES:C(O)(C1CCCCC1)C2CCCCC2
Synonyms:- Ai3-05548
- Cyclohexanemethanol, alpha-cyclohexyl-
- Cyclohexanemethanol, α-cyclohexyl-
- Dicyclohexylcarbinol
- Dodecahydrobenzhydrol
- Methanol, dicyclohexyl-
- NSC 60010
- alpha-Cyclohexylcyclohexanemethanol
- α-Cyclohexylcyclohexanemethanol
- Dicyclohexylmethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Dicyclohexylmethanol
CAS:Applications Dicyclohexylmethanol is a useful reagent for the synthetic preparation of cyclohexane derivatives.
References Moos, G., et al.: Angew. Chem. Int., 59, 11977 (2020)Formula:C13H24OColor and Shape:NeatMolecular weight:196.32Dicyclohexylmethanol
CAS:Dicyclohexylmethanol is a trifunctional compound that contains a hydroxyl group, and can be used as a hydrogen bond donor or acceptor. The chemical structure of dicyclohexylmethanol can be seen in the figure below. Dicyclohexylmethanol has been used for sample preparation for hydrogen chloride gas. It has also been used to determine the concentration of blood ethanol levels and to measure blood pH in humans. Dicyclohexylmethanol is an important reactant in asymmetric synthesis reactions due to its ability to form hydrogen bonds with both reactants.
Formula:C13H24OPurity:Min. 95%Molecular weight:196.33 g/mol






