CymitQuimica logo

CAS 447-43-8

:

4-Fluorophenylglyoxal hydrate

Description:
4-Fluorophenylglyoxal hydrate is an organic compound characterized by the presence of a fluorine atom attached to a phenyl ring and a glyoxal functional group. Its molecular structure includes a carbonyl group, which contributes to its reactivity, particularly in condensation reactions and as a potential electrophile. The hydrate form indicates the presence of water molecules associated with the compound, which can influence its solubility and stability. Typically, compounds like 4-Fluorophenylglyoxal hydrate exhibit moderate to high solubility in polar solvents due to the presence of functional groups capable of hydrogen bonding. This compound may be utilized in various chemical syntheses, including the preparation of more complex organic molecules. Additionally, the fluorine substitution can enhance the compound's electronic properties, making it useful in medicinal chemistry and material science. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate storage conditions should be maintained to preserve its integrity.
Formula:C8H5FO2.xH2O
InChI:InChI=1S/C8H5FO2.H2O/c9-7-3-1-6(2-4-7)8(11)5-10;/h1-5H;1H2
InChI key:JZJXSEZCPBRRLU-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)C=O)F.O
Found 4 products.