CymitQuimica logo

CAS 447-44-9

:

4-Fluoro-1H-indazole-6-carboxylic acid

Description:
4-Fluoro-1H-indazole-6-carboxylic acid is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 4-position and a carboxylic acid functional group at the 6-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its carboxylic acid functionality. It may exhibit acidic behavior due to the carboxylic group, allowing it to participate in various chemical reactions, such as esterification or amidation. The fluorine substituent can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 4-Fluoro-1H-indazole-6-carboxylic acid can serve as a building block in the synthesis of more complex molecules, potentially leading to applications in pharmaceuticals or agrochemicals. Its CAS number, 447-44-9, is a unique identifier used for regulatory and safety purposes.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-6-1-4(8(12)13)2-7-5(6)3-10-11-7/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=UCNORABQJKZNGX-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(C(O)=O)=C1)NN=C2
Synonyms:
  • 1H-Indazole-6-carboxylic acid, 4-fluoro-
  • 4-Fluoro-1H-indazole-6-carboxylic acid
  • 4-Fluoro-6-(1H)Indazole Carboxylic Acid
  • 4-Fluoroindazole-6-Carboxylic Acid
Found 4 products.