CymitQuimica logo

CAS 447464-03-1

:

2-fluoro-3-iodobenzoic acid

Description:
2-Fluoro-3-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both fluorine and iodine substituents on the benzene ring. The fluorine atom is located at the second position, while the iodine atom is at the third position relative to the carboxylic acid group. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The presence of halogens, particularly iodine, can influence the compound's reactivity, making it a useful intermediate in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. The molecular structure contributes to its unique physical and chemical properties, including its melting point and boiling point, which are influenced by the strength of intermolecular interactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.
Formula:C7H4FIO2
InChI:InChI=1/C7H4FIO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)
InChI key:FVLHWICBHZCKED-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1)I)F)C(=O)O
Synonyms:
  • Benzoic acid, 2-fluoro-3-iodo-
Found 4 products.