CAS 4481-62-3: (+)-Betulonic acid
Description:(+)-Betulonic acid is a naturally occurring triterpenoid compound derived from the bark of birch trees, particularly Betula species. It is characterized by its pentacyclic structure, which includes a cyclopentanoperhydrophenanthrene core. The compound exhibits a white to off-white crystalline appearance and is known for its potential biological activities, including anti-inflammatory and anticancer properties. (+)-Betulonic acid is soluble in organic solvents such as ethanol and chloroform but has limited solubility in water. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior. The compound's stereochemistry, indicated by the (+) designation, suggests it has a specific spatial arrangement that may influence its biological interactions. Research into (+)-Betulonic acid continues to explore its pharmacological potential, making it a subject of interest in natural product chemistry and medicinal research.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-22,24H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,24+,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=SLJTWDNVZKIDAU-SVAFSPIFSA-N
SMILES:O=C(O)C12CCC(C(=C)C)C2C3CCC4C5(C)CCC(=O)C(C)(C)C5CCC4(C)C3(C)CC1
- Synonyms:
- 3-Oxobetulinic acid
- Betulonic Acid
- Betunolic acid
- Liquidambaric acid
- Liquidambronic acid
- Lup-20(29)-En-28-Oic Acid, 3-Oxo-
- Lup-20(30)-en-28-oic acid, 3-oxo-
- Mj 347-Rs
- NSC 152534
- 3-Oxolup-20(29)-en-28-oic acid
- See more synonyms
