CAS 4481-62-3
:(+)-Betulonic acid
Description:
(+)-Betulonic acid is a naturally occurring triterpenoid compound derived from the bark of birch trees, particularly Betula species. It is characterized by its pentacyclic structure, which includes a cyclopentanoperhydrophenanthrene core. The compound exhibits a white to off-white crystalline appearance and is known for its potential biological activities, including anti-inflammatory and anticancer properties. (+)-Betulonic acid is soluble in organic solvents such as ethanol and chloroform but has limited solubility in water. Its molecular formula reflects a specific arrangement of carbon, hydrogen, and oxygen atoms, contributing to its unique chemical behavior. The compound's stereochemistry, indicated by the (+) designation, suggests it has a specific spatial arrangement that may influence its biological interactions. Research into (+)-Betulonic acid continues to explore its pharmacological potential, making it a subject of interest in natural product chemistry and medicinal research.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-22,24H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,24+,27-,28+,29+,30-/m0/s1
InChI key:InChIKey=SLJTWDNVZKIDAU-SVAFSPIFSA-N
SMILES:C(O)(=O)[C@]12[C@@]([C@@]3([C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)C(=O)CC5)[H])[H])[H])([C@H](C(C)=C)CC2)[H]
Synonyms:- 3-Oxobetulinic acid
- Betulonic Acid
- Betunolic acid
- Liquidambaric acid
- Liquidambronic acid
- Lup-20(29)-En-28-Oic Acid, 3-Oxo-
- Lup-20(30)-en-28-oic acid, 3-oxo-
- Mj 347-Rs
- NSC 152534
- 3-Oxolup-20(29)-en-28-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
3-Oxolup-20(29)-En-28-Oic Acid
CAS:3-Oxolup-20(29)-En-28-Oic AcidPurity:98%Molecular weight:454.68g/molLiquidambaric acid
CAS:Betulonic acid has anti-cancer , anti-HIV,hepatoprotective and anti-inflammatory activities, it has antiviral activity against herpes simplex virus, it also suppresses ECHO 6 virus reproduction. Betulonic acid derivatives have a promising cytostatic activity in vitro and could be used as potential leads for the development of new type of anti-cancer agents.Formula:C30H46O3Purity:95%~99%Molecular weight:454.695Betulonic Acid
CAS:Formula:C30H46O3Purity:>95.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:454.70Betulonic acid
CAS:Betulonic acid amide aids liver recovery, reduces fibrosis, and shows potential as an anticancer agent with anticholestatic effects in mice.Formula:C30H46O3Purity:99.49%Color and Shape:SolidMolecular weight:454.68Betulonic acid
CAS:Carboxylic acid with ketone functionFormula:C30H46O3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:454.68(+)-Betulonic Acid
CAS:Controlled ProductApplications (+)-Betulonic Acid shows potent cytotoxic activities against PC3, MGC-803, Bcap-37, and MCF-7 cell lines.
References Liu, M., et. al.: Molecules, 17, 6156 (2012)Formula:C30H46O3Color and Shape:NeatMolecular weight:454.68Betulonicacid
CAS:Betulonic acid is a naturally occurring triterpenoid compound, which is sourced from the bark of certain species of birch trees, mainly Betula species. It exhibits anti-inflammatory and anti-cancer properties, primarily through the modulation of various signaling pathways involved in inflammation and apoptosis. Betulonic acid acts by inhibiting key enzymes and transcription factors, such as cyclooxygenase and NF-κB, thereby reducing the production of pro-inflammatory mediators and promoting cell death in cancerous cells.Formula:C30H46O3Purity:Min. 95%Molecular weight:454.68 g/mol











