CymitQuimica logo

CAS 448245-52-1

:

1-butyl-3-methyl-1H-imidazol-3-ium [(cyanoimino)methylidene]azanide

Description:
1-Butyl-3-methyl-1H-imidazol-3-ium [(cyanoimino)methylidene]azanide is a complex organic compound characterized by its imidazolium structure, which features a butyl and a methyl group attached to the nitrogen atoms of the imidazole ring. This compound is notable for its ionic nature, as it contains a positively charged imidazolium cation and a negatively charged azanide anion. The presence of the cyanoimino group contributes to its reactivity and potential applications in various chemical processes, including catalysis and as a ligand in coordination chemistry. The compound's solubility is likely influenced by the butyl group, which enhances its hydrophobic characteristics, while the imidazolium moiety can engage in hydrogen bonding and ionic interactions. Additionally, the structural features of this compound may allow it to participate in various chemical reactions, making it of interest in synthetic organic chemistry and materials science. Its unique properties stem from the combination of the imidazolium framework and the functional groups present, which can be tailored for specific applications.
Formula:C10H15N5
InChI:InChI=1/C8H15N2.C2N3/c1-3-4-5-10-7-6-9(2)8-10;3-1-5-2-4/h6-8H,3-5H2,1-2H3;/q+1;-1
InChI key:ICIVTHOGIQHZRY-UHFFFAOYSA-N
SMILES:CCCCN1C=C[N+](=C1)C.C(=[N-])=NC#N
Synonyms:
  • 1-Butyl-3-Methylimidazolium Dicyanamide
Found 8 products.