CAS 449758-17-2
:1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole
Description:
1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole, identified by its CAS number 449758-17-2, is an organic compound characterized by its unique structural features, which include a pyrazole ring and a tetrahydro-2H-pyran moiety. This compound typically exhibits properties common to heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of nitrogen atoms in the pyrazole ring. The tetrahydro-2H-pyran group contributes to its cyclic structure, which can influence its chemical reactivity and stability. The presence of both nitrogen and oxygen in its structure may allow for various functional group transformations, making it a candidate for applications in medicinal chemistry and material science. Additionally, compounds of this nature may exhibit biological activity, although specific pharmacological properties would require further investigation. Overall, 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole represents a versatile scaffold for further chemical exploration and potential applications.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-2-7-11-8(4-1)10-6-3-5-9-10/h3,5-6,8H,1-2,4,7H2
InChI key:InChIKey=IMZWSOSYNFVECD-UHFFFAOYSA-N
SMILES:N1(C=CC=N1)C2CCCCO2
Synonyms:- 1-(2-Tetrahydropyranyl)-1H-pyrazole
- 1-(Oxan-2-yl)pyrazole
- 1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole
- 1-(Tetrahydro-pyran-2-yl)-1H-pyrazole
- 1-(oxan-2-yl)-1H-pyrazole
- 1H-Pyrazole, 1-(tetrahydro-2H-pyran-2-yl)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole
CAS:Formula:C8H12N2OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:152.201-(2-Tetrahydropyranyl)-1H-pyrazole
CAS:Formula:C8H12N2OPurity:97%Color and Shape:LiquidMolecular weight:152.19371-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazole
CAS:1-(Tetrahydro-2H-pyran-2-yl)-1H-pyrazoleFormula:C8H12N2OPurity:>97%Color and Shape:Pale yellow LiquidMolecular weight:152.193681-(2-Tetrahydropyranyl)-1H-pyrazole
CAS:1-(2-Tetrahydropyranyl)-1H-pyrazoleFormula:C8H12N2OPurity:98+%Molecular weight:152.191-(2-Tetrahydropyranyl)-1h-pyrazole
CAS:1-(2-Tetrahydropyranyl)-1H-pyrazole is a fluxional molecule that can reversibly attack the metal center and quantitatively coordinate to it. The timescale of the reaction is on the order of seconds, but 1-(2-Tetrahydropyranyl)-1H-pyrazole can be observed in the gas phase for hours. This fluxional molecule has been shown to reversibly attack palladium at the 2 position of the pyrimidinyl moiety. The attacking nucleophile is a carbon monoxide molecule, which coordinates to palladium through a mononuclear mechanism.
Formula:C8H12N2OPurity:Min. 95%Color and Shape:Colourless To Yellow Clear LiquidMolecular weight:152.19 g/mol1-(2-Tetrahydropyranyl)-1H-pyrazole
CAS:Formula:C8H12N2OPurity:98%Color and Shape:LiquidMolecular weight:152.197





