CAS 4498-68-4
:1H-Indazole-3-carboxylic acid, ethyl ester
Description:
1H-Indazole-3-carboxylic acid, ethyl ester, with the CAS number 4498-68-4, is an organic compound characterized by its indazole core structure, which consists of a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with an ethyl group, contributing to its solubility and reactivity. Typically, it appears as a white to off-white solid or crystalline substance. The presence of the indazole moiety imparts unique chemical properties, making it of interest in various fields, including medicinal chemistry and material science. It may exhibit biological activity, potentially serving as a scaffold for drug development. The compound is likely to be soluble in organic solvents, such as ethanol and dichloromethane, while being less soluble in water due to its hydrophobic indazole structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-2-14-10(13)9-7-5-3-4-6-8(7)11-12-9/h3-6H,2H2,1H3,(H,11,12)
InChI key:InChIKey=YLKPTYMNELPKOL-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NN1)=CC=CC2
Synonyms:- 1H-Indazole-3-carboxylic acid ethyl ester
- 3-Ethoxycarbonylindazole
- Ethyl 3-indazolecarboxylate
- NSC 179807
- Ethyl 1H-indazole-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 1H-indazole-3-carboxylate
CAS:Ethyl 1H-indazole-3-carboxylateFormula:C10H10N2O2Purity:95%Color and Shape:SolidMolecular weight:190.19859Ethyl 1H-indazole-3-carboxylate
CAS:Formula:C10H10N2O2Purity:95%Color and Shape:SolidMolecular weight:190.1986Ethyl 1H-indazole-3-carboxylate
CAS:Formula:C10H10N2O2Purity:95%Color and Shape:SolidMolecular weight:190.202Ethyl 1H-indazole-3-carboxylate
CAS:Controlled ProductEthyl 1H-indazole-3-carboxylate is a synthetic cannabinoid that is chemically and synthetically derived from the natural compound of tetrahydrocannabinol. It binds to cannabinoid receptors in the brain, inducing psychoactive effects. Ethyl 1H-indazole-3-carboxylate has been shown to inhibit the activity of enzymes such as human liver esterases and carboxylesterases, which are responsible for catalyzing esterification reactions. This drug also inhibits the synthesis of other cannabinoids by blocking their biosynthesis at an early step.Formula:C10H10N2O2Purity:Min. 95%Molecular weight:190.2 g/mol




