CymitQuimica logo

CAS 45159-25-9

:

H-Ala-D-Glu-NH2

Description:
H-Ala-D-Glu-NH2, also known as a peptide, is a compound that consists of the amino acids alanine (Ala) and D-glutamic acid (D-Glu) linked by a peptide bond, with an amine group (NH2) at one end. This structure suggests that it may exhibit properties typical of peptides, such as being soluble in water and having a specific biological activity, potentially influencing protein synthesis or acting as a signaling molecule in biological systems. The presence of the D-isomer of glutamic acid may impart unique characteristics, as D-amino acids can affect the stability and function of peptides in biological contexts. Additionally, the amine group at the terminal position can participate in further chemical reactions, making this compound versatile in synthetic and biological applications. Its CAS number, 45159-25-9, allows for precise identification in chemical databases, facilitating research and development in fields such as biochemistry, pharmacology, and materials science.
Formula:C8H15N3O4
InChI:InChI=1S/C8H15N3O4/c1-4(9)8(15)11-5(7(10)14)2-3-6(12)13/h4-5H,2-3,9H2,1H3,(H2,10,14)(H,11,15)(H,12,13)/t4-,5+/m0/s1
InChI key:NKUHWWPUOXOIIR-CRCLSJGQSA-N
SMILES:C[C@@H](C(=O)N[C@H](CCC(=O)O)C(=O)N)N
Found 5 products.