CAS 452-85-7
:5-Fluoro-2-methylphenol
Description:
5-Fluoro-2-methylphenol, with the CAS number 452-85-7, is an organic compound that belongs to the class of phenols. It features a fluorine atom and a methyl group attached to a benzene ring, specifically at the 5 and 2 positions, respectively. This compound is typically a white to light yellow solid at room temperature and is known for its moderate solubility in water, while being more soluble in organic solvents. The presence of the fluorine atom can influence its chemical reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. 5-Fluoro-2-methylphenol exhibits characteristics typical of phenolic compounds, such as the ability to form hydrogen bonds and participate in electrophilic aromatic substitution reactions. Additionally, it may possess antimicrobial properties, which can be relevant in the development of disinfectants or preservatives. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C7H7FO
InChI:InChI=1/C7H7FO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3
InChI key:InChIKey=CKJOSIHYVLHIER-UHFFFAOYSA-N
SMILES:OC1=C(C)C=CC(F)=C1
Synonyms:- 2-Methyl-5-fluorophenol
- Phenol, 5-fluoro-2-methyl-
- Qr Cf F1
- Qr Cf F1 [Wln]
- o-Cresol, 5-fluoro-
- 5-Fluoro-2-methylphenol
- 5-Fluoro-o-cresol (OH=1)
- 5-fluoro-o-cresol
- 4-fluoro-2-hydroxytoluene
- 5-Fluoro-2-methylphenol,98%
- 5-Fluoro-2-methylphenol 98%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
5-Fluoro-o-cresol
CAS:Formula:C7H7FOPurity:>98.0%(GC)Color and Shape:Colorless to Red to Green clear liquidMolecular weight:126.13Phenol, 5-fluoro-2-methyl-
CAS:Formula:C7H7FOPurity:98%Color and Shape:LiquidMolecular weight:126.12835-Fluoro-2-methylphenol, min. 98%
CAS:Formula:C7H7FOPurity:min. 98%Color and Shape:Colorless liquidMolecular weight:126.135-Fluoro-2-methylphenol
CAS:5-Fluoro-2-methylphenolFormula:C7H7FOPurity:97%Color and Shape:Colourless LiquidMolecular weight:126.128285-Fluoro-2-methylphenol
CAS:The fluoroquinolone 5-Fluoro-2-methylphenol (5FM) is an inhibitor of angiotensin, an enzyme that is involved in the regulation of blood pressure and fluid balance. The structure of this compound was optimized to make it more potent and selective for angiotensin, while minimizing its adverse effects. This optimization was achieved using high throughput screening and x-ray crystallography. The fluorine atom in 5FM binds to aspartyl protease, which prevents the protease from breaking down proteins into smaller amino acid chains. This binding also inhibits the activity of other enzymes that are involved in protein synthesis, such as aspartyl proteases and salicylic acid esterases. 5FM has been shown to inhibit the growth of bacteria such as Staphylococcus aureus at concentrations that are not toxic to mammalian cells.Formula:C7H7FOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:126.13 g/mol5-Fluoro-2-methylphenol
CAS:Formula:C7H7FOPurity:98%Color and Shape:Liquid, ClearMolecular weight:126.13






