CAS 4522-93-4: Ethyl 2,3,4,5,6-pentafluorobenzoate
Description:Ethyl 2,3,4,5,6-pentafluorobenzoate is a fluorinated aromatic compound characterized by the presence of five fluorine atoms attached to a benzene ring, specifically at the 2, 3, 4, 5, and 6 positions, along with an ethyl ester functional group. This compound is known for its high electronegativity due to the fluorine substituents, which significantly influence its chemical reactivity and physical properties. It typically exhibits low volatility and high stability, making it useful in various applications, including as a reagent in organic synthesis and in the development of fluorinated materials. The presence of multiple fluorine atoms enhances its lipophilicity and can affect its solubility in organic solvents. Additionally, the compound may demonstrate unique spectroscopic properties, making it valuable for analytical purposes. Safety considerations should be taken into account due to the potential toxicity associated with fluorinated compounds. Overall, ethyl 2,3,4,5,6-pentafluorobenzoate is a notable example of a highly fluorinated organic molecule with distinct characteristics.
Formula:C9H5F5O2
InChI:InChI=1S/C9H5F5O2/c1-2-16-9(15)3-4(10)6(12)8(14)7(13)5(3)11/h2H2,1H3
InChI key:InChIKey=DFUDMSIRGGTHGI-UHFFFAOYSA-N
SMILES:O=C(OCC)C=1C(F)=C(F)C(F)=C(F)C1F
- Synonyms:
- (Ethoxycarbonyl)pentafluorobenzene
- Benzoic acid, 2,3,4,5,6-pentafluoro-, ethyl ester
- Benzoic acid, pentafluoro-, ethyl ester
- Ethyl 2,3,4,5,6-pentafluorobenzoate
- Pentafluorobenzoic acid ethyl ester
- Ethyl pentafluorobenzoate
