CAS 4522-93-4
:Ethyl 2,3,4,5,6-pentafluorobenzoate
Description:
Ethyl 2,3,4,5,6-pentafluorobenzoate is a fluorinated aromatic compound characterized by the presence of five fluorine atoms attached to a benzene ring, specifically at the 2, 3, 4, 5, and 6 positions, along with an ethyl ester functional group. This compound is known for its high electronegativity due to the fluorine substituents, which significantly influence its chemical reactivity and physical properties. It typically exhibits low volatility and high stability, making it useful in various applications, including as a reagent in organic synthesis and in the development of fluorinated materials. The presence of multiple fluorine atoms enhances its lipophilicity and can affect its solubility in organic solvents. Additionally, the compound may demonstrate unique spectroscopic properties, making it valuable for analytical purposes. Safety considerations should be taken into account due to the potential toxicity associated with fluorinated compounds. Overall, ethyl 2,3,4,5,6-pentafluorobenzoate is a notable example of a highly fluorinated organic molecule with distinct characteristics.
Formula:C9H5F5O2
InChI:InChI=1S/C9H5F5O2/c1-2-16-9(15)3-4(10)6(12)8(14)7(13)5(3)11/h2H2,1H3
InChI key:InChIKey=DFUDMSIRGGTHGI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- (Ethoxycarbonyl)pentafluorobenzene
- Benzoic acid, 2,3,4,5,6-pentafluoro-, ethyl ester
- Benzoic acid, pentafluoro-, ethyl ester
- Ethyl 2,3,4,5,6-pentafluorobenzoate
- Pentafluorobenzoic acid ethyl ester
- Ethyl pentafluorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethyl Pentafluorobenzoate
CAS:Formula:C9H5F5O2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:240.13Ethyl pentafluorobenzoate, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H5F5O2Purity:98%Color and Shape:Liquid, Clear colorless to yellowMolecular weight:240.13Ethyl pentafluorobenzoate
CAS:Ethyl pentafluorobenzoateFormula:C9H5F5O2Purity:98%Color and Shape:Colourless LiquidMolecular weight:240.12681Ethyl 2,3,4,5,6-pentafluorobenzoate
CAS:Formula:C9H5F5O2Purity:98%Color and Shape:LiquidMolecular weight:240.1268Ethyl 2,3,4,5,6-pentafluorobenzoate
CAS:Ethyl 2,3,4,5,6-pentafluorobenzoateFormula:C9H5F5O2Purity:98%Molecular weight:240.13Ethyl pentafluorobenzoate
CAS:Formula:C9H5F5O2Purity:98%Color and Shape:SolidMolecular weight:240.129





