CAS 45234-02-4
:Lysylglutamic acid
Description:
Lysylglutamic acid, with the CAS number 45234-02-4, is a dipeptide composed of the amino acids lysine and glutamic acid. It features a basic side chain due to the presence of the amino group from lysine, which contributes to its overall positive charge at physiological pH. This compound is characterized by its ability to form hydrogen bonds and participate in ionic interactions, making it soluble in water. Lysylglutamic acid plays a role in various biological processes, including protein synthesis and cellular signaling. Its structure includes a carboxyl group from glutamic acid and an amino group from lysine, which can influence its reactivity and interactions with other biomolecules. Additionally, it may exhibit properties such as buffering capacity due to the presence of both acidic and basic functional groups. This dipeptide is of interest in biochemical research and potential therapeutic applications, particularly in the fields of nutrition and medicine, where it may influence metabolic pathways or cellular functions.
Formula:C11H21N3O5
InChI:InChI=1S/C11H21N3O5/c12-6-2-1-3-7(13)10(17)14-8(11(18)19)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1
InChI key:InChIKey=UGTZHPSKYRIGRJ-YUMQZZPRSA-N
SMILES:[C@H](NC([C@H](CCCCN)N)=O)(CCC(O)=O)C(O)=O
Synonyms:- 1072: PN: EP2071334 SEQID:1140 claimed protein
- 1072: PN: WO2009077864 SEQID: 1140 claimed protein
- 72: PN: EP2161028 PAGE: 10 claimed protein
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, <smallcap>L</span>-lysyl-
- <span class="text-smallcaps">L</smallcap>-Glutamic acid, N-<smallcap>L</span>-lysyl-
- <span class="text-smallcaps">L</smallcap>-Lysyl-<smallcap>L</span>-glutamic acid
- Glutamic acid, N-<span class="text-smallcaps">L</span>-lysyl-
- Glutamicacid, N-L-lysyl-
- H-Lys-Glu-OH
- L-Glutamic acid, N-L-lysyl-
- L-Lysine-L-glutamic acid
- Lysylglutamic acid
- Vilon
- Vilon (peptide)
- Glutamic acid, N-L-lysyl-
- L-Glutamic acid, L-lysyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Lys-Glu-OH
CAS:Immunomodulating dipeptide showing antitumor activity.Formula:C11H21N3O5Purity:>99%Color and Shape:White PowderMolecular weight:275.31Lysylglutamic acid
CAS:Lysylglutamic acid is a dipeptide composed of the amino acids lysine (Lysine, Lys) and glutamic acid (Glutamic acid, Glu), with an inhibitory constant (Ki) of 1.3 mM for the membrane transport protein PEPT1.Formula:C11H21N3O5Color and Shape:SolidMolecular weight:275.3N-L-Lysyl-L-glutamic acid
CAS:Lysyl-glutamic acid is a potent antagonist that blocks the activity of growth factor-β1, which is vital for the growth of gland cells. Lysyl-glutamic acid has also been shown to inhibit epidermal growth factor and activate tissue culture cells. This drug has also been shown to be carcinogenic in humans and animals, but not in vitro. It is metabolized by hydrolysis to lysine and glutamic acid. The chemical structures of lysyl-glutamic acid are very similar to those of the amino acids lysine and glutamic acid.
Formula:C11H21N3O5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:275.3 g/mol



