CymitQuimica logo

CAS 452919-90-3

:

β-D-Glucopyranoside, (3β,6α,16β,20R,24S)-16,25-bis(acetyloxy)-20,24-epoxy-3-(β-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl (9CI)

Description:
β-D-Glucopyranoside, with the specific structure described, is a glycoside that features a glucopyranosyl moiety linked to a cyclolanostane skeleton. This compound is characterized by its complex structure, which includes multiple functional groups such as acetoxy and epoxy groups, contributing to its chemical reactivity and potential biological activity. The presence of the β-D-xylopyranosyloxy group indicates that it may exhibit specific interactions with biological systems, potentially influencing its solubility and bioavailability. The stereochemistry, denoted by the various α and β configurations, plays a crucial role in determining the compound's three-dimensional conformation and, consequently, its interactions with enzymes or receptors. This compound may be of interest in pharmaceutical research due to its structural complexity and potential therapeutic applications. Additionally, the presence of multiple hydroxyl groups suggests that it could participate in hydrogen bonding, affecting its physical properties such as melting point and solubility in polar solvents. Overall, β-D-Glucopyranoside represents a fascinating subject for further study in the fields of organic chemistry and biochemistry.
Formula:C45H72O16
InChI:InChI=1S/C45H72O16/c1-21(47)56-25-17-42(8)27-16-24(57-38-34(54)32(52)31(51)26(18-46)58-38)35-39(3,4)28(59-37-33(53)30(50)23(49)19-55-37)11-13-45(35)20-44(27,45)15-14-41(42,7)36(25)43(9)12-10-29(61-43)40(5,6)60-22(2)48/h23-38,46,49-54H,10-20H2,1-9H3/t23-,24+,25+,26-,27+,28+,29+,30+,31-,32+,33-,34-,35+,36+,37+,38-,41-,42+,43-,44+,45-/m1/s1
InChI key:CMBYUZZZSKJOOZ-DZNQNAENSA-N
SMILES:CC(=O)O[C@H]1C[C@]2([C@@H]3C[C@@H]([C@@H]4[C@@]5([C@]3(C5)CC[C@@]2([C@H]1[C@]6(CC[C@H](O6)C(C)(C)OC(=O)C)C)C)CC[C@@H](C4(C)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)C
Synonyms:
  • β-D-Glucopyranoside, (3β,6α,16β,20R,24S)-16,25-bis(acetyloxy)-20,24-epoxy-3-(β-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl
  • β-D-Glucopyranoside, (3β,6α,16β,20R,24S)-16,25-bis(acetyloxy)-20,24-epoxy-3-(β-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl (9CI)
  • Cyclosiversioside F, 16,25-diacetate
  • 16,25-Diacetate cyclosiversioside F
Found 3 products.