CymitQuimica logo

CAS 453565-90-7

:

3-Bromo-5-(trifluoromethoxy)benzoic acid

Description:
3-Bromo-5-(trifluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a trifluoromethoxy group attached to a benzoic acid framework. The molecular structure features a benzene ring with a carboxylic acid (-COOH) functional group, which contributes to its acidic properties. The trifluoromethoxy group (-O-CF3) enhances the compound's lipophilicity and can influence its reactivity and interaction with biological systems. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique substituents can impart specific electronic and steric effects, making it valuable in medicinal chemistry for developing compounds with desired biological activities. Additionally, the presence of fluorine atoms often increases the stability and metabolic resistance of the compound, which can be advantageous in drug design. Safety and handling precautions should be observed due to the potential hazards associated with brominated and fluorinated compounds.
Formula:C8H4BrF3O3
InChI:InChI=1S/C8H4BrF3O3/c9-5-1-4(7(13)14)2-6(3-5)15-8(10,11)12/h1-3H,(H,13,14)
InChI key:OYWFMHKHBDYTKB-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1OC(F)(F)F)Br)C(=O)O
Synonyms:
  • Benzoic acid, 3-bromo-5-(trifluoromethoxy)-
  • 3-Bromo-5-trifluoromethoxybenzoicacid
Found 4 products.