
CAS 4546-68-3
:2′-Deoxynebularine
Description:
2′-Deoxynebularine is a nucleoside analog that is structurally related to purine nucleosides. It features a ribose sugar moiety that is deoxygenated at the 2′ position, which is characteristic of deoxynucleosides. This compound is known for its potential antiviral and anticancer properties, as it can interfere with nucleic acid synthesis. The presence of the nebularine base, which is a modified purine, contributes to its biological activity. 2′-Deoxynebularine is typically studied for its effects on various biological systems, including its ability to inhibit viral replication and its potential use in therapeutic applications. Its chemical structure allows it to mimic natural nucleosides, making it a valuable compound in medicinal chemistry and pharmacology. As with many nucleoside analogs, the pharmacokinetics and toxicity profiles are important considerations in its development for clinical use. Overall, 2′-Deoxynebularine represents a significant area of research in the field of drug discovery and development.
Formula:C10H12N4O3
InChI:InChI=1S/C10H12N4O3/c15-3-8-7(16)1-9(17-8)14-5-13-6-2-11-4-12-10(6)14/h2,4-5,7-9,15-16H,1,3H2/t7-,8+,9+/m0/s1
InChI key:InChIKey=WJBNIBFTNGZFBW-DJLDLDEBSA-N
SMILES:C(O)[C@H]1O[C@@H](N2C=3C(N=C2)=CN=CN3)C[C@@H]1O
Synonyms:- 9-(2-Deoxy-β-D-erythro-pentofuranosyl)-9H-purine
- 9H-Purine, 9-(2-deoxy-β-D-erythro-pentofuranosyl)-
- NSC 108611
- 2′-Deoxynebularine
- NSC 409825
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(2R,3S,5R)-2-(Hydroxymethyl)-5-(9H-purin-9-yl)tetrahydrofuran-3-ol
CAS:(2R,3S,5R)-2-(Hydroxymethyl)-5-(9H-purin-9-yl)tetrahydrofuran-3-olFormula:C10H12N4O3Purity:98%Molecular weight:236.232'-Deoxynebularine
CAS:2'-Deoxynebularine is a nucleoside analog that has been shown to inhibit the replication of human immunodeficiency virus type 1 (HIV-1) in vitro. 2'-Deoxynebularine binds to the viral DNA and inhibits its synthesis by hydrogen bonding with the sugar-phosphate backbone. This inhibition prevents the production of new viral DNA and stops viral replication. The drug also inhibits cellular proliferation, which may be due to its ability to inhibit oxidative DNA damage in animal cells. This drug has been shown to inhibit enzyme activities in both human skin cells and leukemia cells, which may be due to its ability to act as a substrate for various enzymes. It is also an effective inhibitor of cellular protein synthesis.Formula:C10H12N4O3Purity:Min. 95%Molecular weight:236.23 g/mol


