CymitQuimica logo

CAS 454678-91-2

:

(4-thiazol-2-ylphenyl)methanol

Description:
(4-thiazol-2-ylphenyl)methanol is an organic compound characterized by the presence of a thiazole ring and a phenyl group, linked through a methanol functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the thiazole moiety, which is known for its role in various pharmacological applications. The presence of the hydroxymethyl group (-CH2OH) suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The compound may also display moderate polarity, making it soluble in polar solvents while retaining some hydrophobic characteristics due to the phenyl group. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the thiazole and phenyl groups, which may affect its synthesis and application in various chemical reactions or as a pharmaceutical agent.
Formula:C10H9NOS
InChI:InChI=1/C10H9NOS/c12-7-8-1-3-9(4-2-8)10-11-5-6-13-10/h1-6,12H,7H2
SMILES:c1cc(ccc1CO)c1nccs1
Found 3 products.