CymitQuimica logo

CAS 455-17-4

:

1-Fluoro-4-(trimethylsilyl)benzene

Description:
1-Fluoro-4-(trimethylsilyl)benzene, with the CAS number 455-17-4, is an organofluorine compound characterized by the presence of a fluorine atom and a trimethylsilyl group attached to a benzene ring. This compound typically exhibits a clear to pale yellow liquid form at room temperature and is known for its relatively low volatility. The presence of the fluorine atom enhances its chemical stability and can influence its reactivity, making it useful in various synthetic applications. The trimethylsilyl group contributes to its hydrophobic properties and can serve as a protecting group in organic synthesis. Additionally, this compound is often utilized in the field of materials science and as an intermediate in the synthesis of other chemical entities. Its unique structural features allow for diverse applications, particularly in the development of fluorinated materials and pharmaceuticals. As with many organofluorine compounds, handling should be done with care due to potential toxicity and environmental concerns associated with fluorinated substances.
Formula:C9H13FSi
InChI:InChI=1S/C9H13FSi/c1-11(2,3)9-6-4-8(10)5-7-9/h4-7H,1-3H3
InChI key:InChIKey=VZKFVPRKXHZBQO-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=CC=C(F)C=C1
Synonyms:
  • 1-Fluoro-4-(trimethylsilyl)benzene
  • Silane, (4-fluorophenyl)trimethyl-
  • Benzene, 1-fluoro-4-(trimethylsilyl)-
  • 1-Fluoro-4-(trimethylsily)benzene
  • (p-Fluorophenyl)trimethylsilane
  • Silane, (p-fluorophenyl)trimethyl-
Found 4 products.