CymitQuimica logo

CAS 455941-78-3

:

Methyl 4-(trifluoromethyl)pyridine-2-carboxylate

Description:
Methyl 4-(trifluoromethyl)pyridine-2-carboxylate is an organic compound characterized by its pyridine ring structure, which is substituted at the 2-position with a carboxylate group and at the 4-position with a trifluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its polar nature due to the presence of the carboxylate group, which can engage in hydrogen bonding, while the trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and interaction with other molecules. Methyl 4-(trifluoromethyl)pyridine-2-carboxylate is often utilized in organic synthesis and medicinal chemistry, serving as an intermediate in the production of various pharmaceuticals and agrochemicals. Its unique electronic properties, imparted by the trifluoromethyl group, can enhance biological activity and selectivity in target interactions. As with many fluorinated compounds, it may exhibit stability under various conditions, making it a valuable building block in chemical synthesis.
Formula:C8H6F3NO2
InChI:InChI=1/C8H6F3NO2/c1-14-7(13)6-4-5(2-3-12-6)8(9,10)11/h2-4H,1H3
InChI key:DMCIYNOPRUVFHE-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(ccn1)C(F)(F)F
Found 4 products.