CAS 4569-45-3
:9,9-Dimethyl-9H-fluorene
Description:
9,9-Dimethyl-9H-fluorene is an organic compound characterized by its polycyclic aromatic structure, which consists of a fluorene core with two methyl groups attached to the 9-position. This compound is typically a white to pale yellow solid at room temperature and is known for its stability and relatively low reactivity due to the presence of the aromatic system. It has a high melting point and is soluble in organic solvents such as benzene and toluene, but is less soluble in water. 9,9-Dimethyl-9H-fluorene is often used in organic synthesis and materials science, particularly in the development of organic semiconductors and light-emitting diodes (OLEDs). Its unique electronic properties make it a subject of interest in research related to photonics and optoelectronics. Additionally, it may exhibit fluorescence, which can be advantageous in various applications, including sensors and imaging technologies. Safety precautions should be taken when handling this compound, as with many organic chemicals, to avoid potential health hazards.
Formula:C15H14
InChI:InChI=1/C15H14/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,1-2H3
SMILES:CC1(C)c2ccccc2c2ccccc12
Synonyms:- 9,9'-Dimethyl fluorene
- 9,9'-Dimethylfluorenee
- 9,9-Dimethylfluorene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9,9-Dimethylfluorene (purified by sublimation)
CAS:Formula:C15H14Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:194.289,9-Dimethylfluorene
CAS:Formula:C15H14Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:194.289,9-Dimethyl-9H-fluorene
CAS:9,9-Dimethyl-9H-fluoreneis a high purity biochemical reagent that can be used in research related to life sciences.Formula:C15H14Purity:99.89%Color and Shape:SolidMolecular weight:194.279,9-Dimethyl-9H-fluorene
CAS:9,9-Dimethyl-9H-fluoreneFormula:C15H14Purity:98%Color and Shape:LiquidMolecular weight:194.277





