CAS 4570-41-6
:2-Benzoxazolamine
Description:
2-Benzoxazolamine, with the CAS number 4570-41-6, is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as moderate solubility in organic solvents and may have varying solubility in water depending on the pH. The presence of an amino group in its structure contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 2-benzoxazolamine may exhibit biological activity, making it of interest in medicinal chemistry for the development of therapeutic agents. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations in its handling and application. Overall, 2-benzoxazolamine is a compound of interest due to its unique structural features and potential utility in diverse chemical applications.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H2,8,9)
InChI key:InChIKey=JPBLHOJFMBOCAF-UHFFFAOYSA-N
SMILES:NC1=NC=2C(O1)=CC=CC2
Synonyms:- 1,3-Benzoxazol-2-Amine
- 2-Aminobenzoxazole
- 2-Benzoxazolamine
- Ai3-63115
- Benzo[d]oxazol-2-amine
- Benzooxazol-2-Ylamine
- Benzoxazole, 2-amino-
- Nsc 26184
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Aminobenzoxazole
CAS:Formula:C7H6N2OPurity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:134.14Pramipexole Impurity 26
CAS:Formula:C7H6N2OColor and Shape:White To Off-White SolidMolecular weight:134.142-Amino-1,3-benzoxazole
CAS:2-Amino-1,3-benzoxazoleFormula:C7H6N2OPurity:98%Color and Shape:White SolidMolecular weight:134.135342-Aminobenzoxazole
CAS:Controlled ProductApplications 2-Aminobenzoxazole and its isothiocyanate derivatives are used as antihelminthic agents, and its fluorescence properties make it of use in the dye industry. It is also used as a reagent to synthesize N-benzothiazolyl-2-arylacetamide derivatives, Protein Kinase 1 inhibitors that can be used to treat amyotrophic lateral sclerosis.
References Peshakova, L., et al.: Chem. Hetero. Comp., 17, 741 (1981); Salado, I., et al.: J. Med. Chem., 57, 2755 (2014); Wagh, Y., et al.: Tetrahedron Lett., 53, 3482 (2012)Formula:C7H6N2OColor and Shape:NeatMolecular weight:134.142-Aminobenzoxazole
CAS:Formula:C7H6N2OPurity:95%Color and Shape:Solid, White to pale yellow powderMolecular weight:134.138






