CymitQuimica logo

CAS 45753-18-2

:

1H-Imidazole, 4,5-dihydro-2-(2-thienyl)-

Description:
1H-Imidazole, 4,5-dihydro-2-(2-thienyl)-, with the CAS number 45753-18-2, is a heterocyclic organic compound characterized by its imidazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a thienyl group, which is derived from thiophene, indicating the presence of a sulfur atom in its structure. The dihydro form suggests that the imidazole ring is partially saturated, which can influence its reactivity and stability. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. They may also possess unique electronic properties due to the presence of both nitrogen and sulfur atoms, which can affect their interactions in various chemical environments. Additionally, the presence of the thienyl substituent can enhance solubility and alter the compound's physical properties, such as melting point and boiling point. Overall, this compound represents a class of substances that are valuable in both synthetic and applied chemistry contexts.
Formula:C7H8N2S
InChI:InChI=1S/C7H8N2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-2,5H,3-4H2,(H,8,9)
InChI key:WKJSKRCSMISIOY-UHFFFAOYSA-N
SMILES:C1CN=C(N1)C2=CC=CS2
Found 3 products.