CAS 458532-96-2
:B-(2-Chloro-4-pyridinyl)boronic acid
Description:
B-(2-Chloro-4-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a chlorine substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The chlorine atom on the pyridine ring can influence the compound's reactivity and solubility, potentially enhancing its biological activity or selectivity in chemical reactions. B-(2-Chloro-4-pyridinyl)boronic acid is often utilized in the development of pharmaceuticals, particularly in the synthesis of compounds that target specific biological pathways. Additionally, its boronic acid moiety allows for participation in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a vital method for constructing carbon-carbon bonds in organic synthesis. Overall, this compound is significant in both research and industrial applications due to its versatile reactivity and functional properties.
Formula:C5H5BClNO2
InChI:InChI=1S/C5H5BClNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3,9-10H
InChI key:InChIKey=WJYRVVDXJMJLTN-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(Cl)N=CC1
Synonyms:- (2-Chloro-4-pyridyl)boronic acid
- (2-Chloropyridin-4-yl)boronic acid
- 2-Chloro-4-pyridylboronic acid
- B-(2-Chloro-4-pyridinyl)boronic acid
- Boronic acid, (2-chloro-4-pyridinyl)-
- Boronic acid, (2-chloro-4-pyridinyl)- (9CI)
- Boronic acid, B-(2-chloro-4-pyridinyl)
- 2-Chloropyridine-4-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Chloro-4-pyridylboronic acid
CAS:Formula:C5H5BClNO2Purity:98%Color and Shape:SolidMolecular weight:157.36272-Chloropyridine-4-boronic acid
CAS:2-Chloropyridine-4-boronic acidFormula:C5H5BClNO2Purity:≥95%Color and Shape: off-white powderMolecular weight:157.36g/mol2-Chloropyridine-4-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H5BClNO2Purity:97.0 to 113.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:157.362-Chloropyridine-4-boronic acid
CAS:Formula:C5H5BClNO2Purity:96%Color and Shape:Solid, White solidMolecular weight:157.362-Chloropyridine-4-boronic acid
CAS:<p>2-Chloropyridine-4-boronic acid is a nicotinic acetylcholine receptor antagonist that has been shown to be effective against trypanosomiasis. It blocks the binding of acetylcholine to its receptor, which prevents the propagation of an action potential in the postsynaptic cell. 2-Chloropyridine-4-boronic acid inhibits the enzymes cyclooxygenase and prostaglandin synthase, which are involved in inflammation. 2-Chloropyridine-4-boronic acid is potent and selective for nicotinic acetylcholine receptors, but it also binds to other sites on the enzyme. The molecular modeling studies have shown that this compound has a pharmacophore that can be used as a guide for drug design.</p>Formula:C5H5BClNO2Purity:Min. 95%Molecular weight:157.36 g/mol





